Difference between revisions of "Thebaine"

Jump to: navigation, search
m (1 revision(s))
Line 1: Line 1:
{{Drugbox|
+
<!-- Below the chembox new.  Notes:
|IUPAC_name =6,7,8,14-tetradehydro-4,5a-epoxy-<br />3,6-dimethoxy-17-methylmorphinan
+
* Parameters work only in their own section. 
| image=Thebaine.png
+
* When a parameter is not needed, please leave it empty, when a parameter is wrong, just clear its contents. 
| width=173
+
* When a section is really not needed, delete the whole section.
| CAS_number=115-37-7
+
For more information, see [[template:chembox new]]. -->
| ATC_prefix=
+
{{chembox new
| ATC_suffix=
+
| ImageFile = Thebaine.png
| ATC_supplemental=
+
| ImageSize = 173
| PubChem=5321926
+
| IUPACName = 6,7,8,14-tetradehydro-4,5a-epoxy-<br/>3,6-dimethoxy-17-methylmorphinan
| DrugBank=
+
| OtherNames = Paramorphine
| C =19  | H =21  | N =1  | O =3
+
| Section1 = {{Chembox Identifiers
| molecular_weight = 311.37 g/mol
+
| Abbreviations =  
| bioavailability=  
+
| CASNo = 115-37-7
| metabolism =  
+
| EINECS =  
| elimination_half-life=  
+
| PubChem = 5321926
| excretion =  
+
| SMILES = CN1CCC23C4C(=CC=C2C1CC5=C3C(=C(C=C5)OC)O4)OC
| licence_US =  
+
| InChI =
| pregnancy_AU =  
+
| RTECS =
| pregnancy_US =  
+
| MeSHName = Thebaine
| legal_US = Schedule II
+
| ChEBI = 9519
| legal_status =  
+
| KEGG = C06173
| routes_of_administration=  
+
| ATCCode_prefix =
}}
+
| ATCCode_suffix =
 +
| ATC_Supplemental =}}
 +
| Section2 = {{Chembox Properties
 +
| Formula =
 +
| C =19  | H =21  | N =1  | O =3  
 +
| MolarMass = 311.37 g/mol
 +
| Appearance =
 +
| Density =  
 +
| MeltingPt =
 +
| Melting_notes =
 +
| BoilingPt =
 +
| Boiling_notes =
 +
| Solubility =
 +
| SolubleOther =
 +
| Solvent =
 +
| pKa =
 +
| pKb = }}
 +
| Section3 = {{Chembox Pharmacology
 +
| ProteinBound =
 +
| Bioavail =
 +
| Metabolism = ''O''-demethylation via [[CYP2D6|CYP450 2D6]]<ref name="mikus1991">Mikus G, Somogyi AA, Bochner F, Eichelbaum M. "Thebaine O-demethylation to oripavine: genetic differences between two rat strains." ''Xenobiotica''. 1991 Nov; 21(11):1501-9. PMID 1763524</ref>
 +
| HalfLife =
 +
| Excretion =
 +
| PregCat =  
 +
| PregCat_UK =  
 +
| PregCat_US =  
 +
| PregCat_AU =  
 +
| PregCat_CA =  
 +
| Legal_US = Schedule II
 +
| Legal_UK = Class A
 +
| Legal_AU =  
 +
| Legal_CA =  
 +
| Legal_status =
 +
| AdminRoutes =
 +
| Licence_EU =
 +
| Licence_US =
 +
| Dependency_liability =Low <ref name="who1980"> WHO Advisory Group. [http://www.unodc.org/unodc/en/bulletin/bulletin_1980-01-01_1_page006.html "The dependence potential of thebaine."] ''Bulletin on Narcotics''. 1980; 32(1):45–54. Accessed [[October 5]] [[2007]]. PMID 6778542</ref> }}
 +
}}<!-- Text starts below-->
  
'''Thebaine''' (paramorphine) is an [[opiate]] [[alkaloid]]. A minor constituent of [[opium]], thebaine is chemically similar to both [[morphine]] and [[codeine]], but has stimulatory rather than depressant effects, causing strychnine-like convulsions. Thebaine is not used therapeutically, but is converted industrially into a variety of compounds including [[oxycodone]], [[oxymorphone]], [[nalbuphine]], [[naloxone]], [[naltrexone]], [[buprenorphine]] and [[etorphine]].  
+
 
 +
'''Thebaine''' (paramorphine) is an [[opiate]] [[alkaloid]]. A minor constituent of [[opium]], thebaine is chemically similar to both [[morphine]] and [[codeine]], but has stimulatory rather than depressant effects, causing [[strychnine]]-like convulsions. Thebaine is not used therapeutically, but is converted industrially into a variety of compounds including [[oxycodone]], [[oxymorphone]], [[nalbuphine]], [[naloxone]], [[naltrexone]], [[buprenorphine]] and [[etorphine]].
  
 
It is controlled in Schedule II of the [[Controlled Substances Act]] as well as under international law. Thebaine is listed as a Class A drug under the [[Misuse of Drugs Act 1971]] in the [[United Kingdom]].
 
It is controlled in Schedule II of the [[Controlled Substances Act]] as well as under international law. Thebaine is listed as a Class A drug under the [[Misuse of Drugs Act 1971]] in the [[United Kingdom]].
 +
 +
==References==
 +
<references/>
  
 
{{aromatic-stub}}
 
{{aromatic-stub}}

Revision as of 11:44, 8 October 2007

Template:Chembox E number
Thebaine
IUPAC name 6,7,8,14-tetradehydro-4,5a-epoxy-
3,6-dimethoxy-17-methylmorphinan
Other names Paramorphine
Identifiers
3D model (JSmol)
ChEBI
ECHA InfoCard Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value). Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value).
KEGG
MeSH Thebaine
Properties
C19H21NO3
Molar mass 311.37 g/mol
Pharmacology
Metabolism O-demethylation via CYP450 2D6[1]
Legal status

Class A(UK) Schedule II(US)

Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)

Infobox disclaimer and references


Thebaine (paramorphine) is an opiate alkaloid. A minor constituent of opium, thebaine is chemically similar to both morphine and codeine, but has stimulatory rather than depressant effects, causing strychnine-like convulsions. Thebaine is not used therapeutically, but is converted industrially into a variety of compounds including oxycodone, oxymorphone, nalbuphine, naloxone, naltrexone, buprenorphine and etorphine.

It is controlled in Schedule II of the Controlled Substances Act as well as under international law. Thebaine is listed as a Class A drug under the Misuse of Drugs Act 1971 in the United Kingdom.

References

  1. Mikus G, Somogyi AA, Bochner F, Eichelbaum M. "Thebaine O-demethylation to oripavine: genetic differences between two rat strains." Xenobiotica. 1991 Nov; 21(11):1501-9. PMID 1763524
  2. WHO Advisory Group. "The dependence potential of thebaine." Bulletin on Narcotics. 1980; 32(1):45–54. Accessed October 5 2007. PMID 6778542

Template:Aromatic-stub

de:Thebain it:Tebaina no:Tebain sv:Tebain th:ทีบาอีน


Linked-in.jpg