Ursolic acid

Jump to: navigation, search

Ursolic acid is a pentacyclic triterpene acid which is capable of inhibiting human fibrosarcoma cells by reducing the expression of matrix metalloproteinase-9 by acting through the glucocorticoid receptor.

Ursolic acid is also known as Prunol, Malol, Urson, .beta.-Ursolic acid, NSC4060, CCRIS 7123, CHEBI:9908, TOS-BB-0966, and 3beta-Hydroxyurs-12-en-28-oic acid.

IUPAC Name: (1S,2R,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-10- hydroxy-1,2,6a,6b,9,9,12a- heptamethy l-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b- tetradecahydro -1H- picene-4a- carboxylic acid Canonical SMILES: CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1C)C)C(=O)O Isomeric SMILES: C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O



Linked-in.jpg