Lysine (data page)

Jump to: navigation, search
The complete data for Lysine
350px
File:Hight setter 449px.gifSkeletal structure of L-lysine 3D structure of L-lysine
General information
400px
Chemical formula: C6H14N2O2 
Molar mass: 146.19 g·mol-1
Systematic name:
-2,6-Diaminohexanoic acid
Abbreviations: K, Lys
Synonyms:
none
Database data
SMILES: NCCCCC(N)C(=O)O
InChI=1/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/f/h9H
 ATC: N/A CAS: 56-87-1 DrugBank: N/A EINECS: 200-294-2 [1] PubChem: 866 (DL) [2], 5962 (L) [3]
Physical properties
Structure
Crystal data
Spectral data
UV-Vis
IR
NMR
MS
Phase behavior
Solid properties
Tm: 224 °C
Liquid properties
Gas properties
Hazard properties
MSDS N/AMain hazards:
- N/A
NFPA 704
NFPA 704.svg
Flash point
- N/A
R/S statement
R: N/A
S: N/A
RTECS number:
N/A
Chemical properties
XLogP: -2.926pI: 9.74pKa: 2.15, 9.16, 10.67Tautomers: ?Hydrogen bond: donor - 3;   acceptor - 4;
Pharmacological properties
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)


References

  1. a  EINECS number 200-294-2 (Lysine)
  2. a  CID 866 from PubChem (DL-Lysine)
  3. a  CID 5962 from PubChem (L-Lysine)


v  d  e
Major families of biochemicals
Peptides | Amino acids | Nucleic acids | Carbohydrates | Nucleotide sugars | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides
Analogues of nucleic acids:The 20 Common Amino Acids ("dp" = data page)Analogues of nucleic acids:
Alanine (dp) | Arginine (dp) | Asparagine (dp) | Aspartic acid (dp) | Cysteine (dp) | Glutamic acid (dp) | Glutamine (dp) | Glycine (dp) | Histidine (dp) | Isoleucine (dp) | Leucine (dp) | Lysine (dp) | Methionine (dp) | Phenylalanine (dp) | Proline (dp) | Serine (dp) | Threonine (dp) | Tryptophan (dp) | Tyrosine (dp) | Valine (dp)

ar:لايسين (صفحة بيانات)


Linked-in.jpg