10-Formyl-tetrahydrofolate

Jump to: navigation, search
10-Formyl-tetrahydrofolate
File:10-formyl-tetrahydrofolic acid.svg
IUPAC name 2-[ [4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-1H-pteridin-6-yl)methyl-formyl-amino]benzoyl]amino]pentanedioic acid
Identifiers
CAS number 2800-34-2
PubChem 10
MeSH 10-formyl-tetrahydrofolate
SMILES C1C(NC2=C(N1)NC(=NC2=O)N)CN(C=O)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O
Properties
Molecular formula C20H23N7O7
Molar mass 473.44 g/mol
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)

Infobox disclaimer and references

10-Formyl-tetrahydrofolate is a product of the enzyme serine hydroxymethyltransferase. It is a substrate in formyltransferase reactions, such as catalysed by methionyl-tRNA formyltransferase and phosphoribosylaminoimidazolecarboxamide formyltransferase



Linked-in.jpg